C11H16N6S — CID 54453852
1-cyano-2-methyl-3-[2-(2-pyridazin-3-ylethylsulfanyl)ethyl]guanidine (PubChem CID 54453852) has the molecular formula C11H16N6S and a molecular weight of 264.36 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[2-(2-pyridazin-3-ylethylsulfanyl)ethyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[2-(2-pyridazin-3-ylethylsulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 54453852 |
| Molecular Formula | C11H16N6S |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-cyano-2-methyl-3-[2-(2-pyridazin-3-ylethylsulfanyl)ethyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCSCCc1cccnn1 |
| InChI | InChI=1S/C11H16N6S/c1-13-11(15-9-12)14-6-8-18-7-4-10-3-2-5-16-17-10/h2-3,5H,4,6-8H2,1H3,(H2,13,14,15) |
| InChIKey | WWURDWQWUPOPBJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|