C9H13N5OS — CID 54407518
1-cyano-2-methyl-3-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]guanidine (PubChem CID 54407518) has the molecular formula C9H13N5OS and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 54407518 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 1-cyano-2-methyl-3-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCSCc1ccon1 |
| InChI | InChI=1S/C9H13N5OS/c1-11-9(13-7-10)12-3-5-16-6-8-2-4-15-14-8/h2,4H,3,5-6H2,1H3,(H2,11,12,13) |
| InChIKey | VRTTUQALHOQRRQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|