About methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate
methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate (PubChem CID 21313914) has the molecular formula C9H15N3OS2
and a molecular weight of 245.37 g/mol. Its IUPAC name is methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate |
| PubChem CID | 21313914 |
| Molecular Formula | C9H15N3OS2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate |
| SMILES | C/N=C(/NCCSCc1ccon1)SC |
| InChI | InChI=1S/C9H15N3OS2/c1-10-9(14-2)11-4-6-15-7-8-3-5-13-12-8/h3,5H,4,6-7H2,1-2H3,(H,10,11) |
| InChIKey | RMHSNKLCEODGRR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate?
The IUPAC name of methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate (CID 21313914) is methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate.
What is the SMILES notation for methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate?
The canonical SMILES for methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate is C/N=C(/NCCSCc1ccon1)SC.
What is the InChIKey of methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate?
The InChIKey is RMHSNKLCEODGRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3OS2/c1-10-9(14-2)11-4-6-15-7-8-3-5-13-12-8/h3,5H,4,6-7H2,1-2H3,(H,10,11).
What are the key properties of methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate?
methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate has a molecular weight of 245.37 g/mol, XLogP of 1.85, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-methyl-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate is sourced from PubChem (CID 21313914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).