C11H15ClN6S — CID 54209434
1-[2-[(4-chloro-2-methylpyrimidin-5-yl)methylsulfanyl]ethyl]-3-cyano-2-methylguanidine (PubChem CID 54209434) has the molecular formula C11H15ClN6S and a molecular weight of 298.80 g/mol. Its IUPAC name is 1-[2-[(4-chloro-2-methylpyrimidin-5-yl)methylsulfanyl]ethyl]-3-cyano-2-methylguanidine.
| Compound Name | 1-[2-[(4-chloro-2-methylpyrimidin-5-yl)methylsulfanyl]ethyl]-3-cyano-2-methylguanidine |
|---|---|
| PubChem CID | 54209434 |
| Molecular Formula | C11H15ClN6S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-[2-[(4-chloro-2-methylpyrimidin-5-yl)methylsulfanyl]ethyl]-3-cyano-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCSCc1cnc(C)nc1Cl |
| InChI | InChI=1S/C11H15ClN6S/c1-8-16-5-9(10(12)18-8)6-19-4-3-15-11(14-2)17-7-13/h5H,3-4,6H2,1-2H3,(H2,14,15,17) |
| InChIKey | PUWUREFWVVNPHS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|