C17H18ClN5OS — CID 12849965
methyl N'-[4-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]butyl]-N-cyanocarbamimidothioate (PubChem CID 12849965) has the molecular formula C17H18ClN5OS and a molecular weight of 375.89 g/mol. Its IUPAC name is methyl N'-[4-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]butyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[4-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]butyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 12849965 |
| Molecular Formula | C17H18ClN5OS |
| Molecular Weight | 375.89 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | methyl N'-[4-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]butyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\CCCCn1nc(-c2ccc(Cl)cc2)ccc1=O)NC#N |
| InChI | InChI=1S/C17H18ClN5OS/c1-25-17(21-12-19)20-10-2-3-11-23-16(24)9-8-15(22-23)13-4-6-14(18)7-5-13/h4-9H,2-3,10-11H2,1H3,(H,20,21) |
| InChIKey | YHOVIBNMWAKTDW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.89 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|