C24H27ClN4O2 — CID 16884592
4-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-[4-(diethylamino)phenyl]butanamide (PubChem CID 16884592) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-[4-(diethylamino)phenyl]butanamide.
| Compound Name | 4-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-[4-(diethylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 16884592 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-[4-(diethylamino)phenyl]butanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCCn2nc(-c3ccc(Cl)cc3)ccc2=O)cc1 |
| InChI | InChI=1S/C24H27ClN4O2/c1-3-28(4-2)21-13-11-20(12-14-21)26-23(30)6-5-17-29-24(31)16-15-22(27-29)18-7-9-19(25)10-8-18/h7-16H,3-6,17H2,1-2H3,(H,26,30) |
| InChIKey | IEDQIAJECJETSN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|