C22H23BrN4O2 — CID 16884811
4-[3-(4-bromophenyl)-6-oxopyridazin-1-yl]-N-[4-(dimethylamino)phenyl]butanamide (PubChem CID 16884811) has the molecular formula C22H23BrN4O2 and a molecular weight of 455.36 g/mol. Its IUPAC name is 4-[3-(4-bromophenyl)-6-oxopyridazin-1-yl]-N-[4-(dimethylamino)phenyl]butanamide.
| Compound Name | 4-[3-(4-bromophenyl)-6-oxopyridazin-1-yl]-N-[4-(dimethylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 16884811 |
| Molecular Formula | C22H23BrN4O2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 4-[3-(4-bromophenyl)-6-oxopyridazin-1-yl]-N-[4-(dimethylamino)phenyl]butanamide |
| SMILES | CN(C)c1ccc(NC(=O)CCCn2nc(-c3ccc(Br)cc3)ccc2=O)cc1 |
| InChI | InChI=1S/C22H23BrN4O2/c1-26(2)19-11-9-18(10-12-19)24-21(28)4-3-15-27-22(29)14-13-20(25-27)16-5-7-17(23)8-6-16/h5-14H,3-4,15H2,1-2H3,(H,24,28) |
| InChIKey | PWLOIRCDICIOSM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|