C26H35FN6O3S — CID 91321134
1-cyano-2-[7-[(2-cyclohexyloxy-4-fluorophenyl)sulfonylamino]heptyl]-3-pyridin-4-ylguanidine (PubChem CID 91321134) has the molecular formula C26H35FN6O3S and a molecular weight of 530.67 g/mol. Its IUPAC name is 1-cyano-2-[7-[(2-cyclohexyloxy-4-fluorophenyl)sulfonylamino]heptyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[7-[(2-cyclohexyloxy-4-fluorophenyl)sulfonylamino]heptyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 91321134 |
| Molecular Formula | C26H35FN6O3S |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 1-cyano-2-[7-[(2-cyclohexyloxy-4-fluorophenyl)sulfonylamino]heptyl]-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\CCCCCCCNS(=O)(=O)c1ccc(F)cc1OC1CCCCC1)Nc1ccncc1 |
| InChI | InChI=1S/C26H35FN6O3S/c27-21-11-12-25(24(19-21)36-23-9-5-4-6-10-23)37(34,35)32-16-8-3-1-2-7-15-30-26(31-20-28)33-22-13-17-29-18-14-22/h11-14,17-19,23,32H,1-10,15-16H2,(H2,29,30,31,33) |
| InChIKey | COXOKORSNZXENW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|