C24H39N7O4S — CID 72735246
1-cyano-2-[6-[cyclopentyl(2-morpholin-4-ylethoxy)sulfamoyl]hexyl]-3-pyridin-4-ylguanidine (PubChem CID 72735246) has the molecular formula C24H39N7O4S and a molecular weight of 521.69 g/mol. Its IUPAC name is 1-cyano-2-[6-[cyclopentyl(2-morpholin-4-ylethoxy)sulfamoyl]hexyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[6-[cyclopentyl(2-morpholin-4-ylethoxy)sulfamoyl]hexyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 72735246 |
| Molecular Formula | C24H39N7O4S |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 1-cyano-2-[6-[cyclopentyl(2-morpholin-4-ylethoxy)sulfamoyl]hexyl]-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\CCCCCCS(=O)(=O)N(OCCN1CCOCC1)C1CCCC1)Nc1ccncc1 |
| InChI | InChI=1S/C24H39N7O4S/c25-21-28-24(29-22-9-12-26-13-10-22)27-11-5-1-2-6-20-36(32,33)31(23-7-3-4-8-23)35-19-16-30-14-17-34-18-15-30/h9-10,12-13,23H,1-8,11,14-20H2,(H2,26,27,28,29) |
| InChIKey | FUCNFPVULQQOIL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|