C24H38N4O5S — CID 46233812
(E)-N-[5-[cyclopentyl(2-morpholin-4-ylethoxy)sulfamoyl]pentyl]-3-pyridin-4-ylprop-2-enamide (PubChem CID 46233812) has the molecular formula C24H38N4O5S and a molecular weight of 494.66 g/mol. Its IUPAC name is (E)-N-[5-[cyclopentyl(2-morpholin-4-ylethoxy)sulfamoyl]pentyl]-3-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[cyclopentyl(2-morpholin-4-ylethoxy)sulfamoyl]pentyl]-3-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 46233812 |
| Molecular Formula | C24H38N4O5S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (E)-N-[5-[cyclopentyl(2-morpholin-4-ylethoxy)sulfamoyl]pentyl]-3-pyridin-4-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccncc1)NCCCCCS(=O)(=O)N(OCCN1CCOCC1)C1CCCC1 |
| InChI | InChI=1S/C24H38N4O5S/c29-24(9-8-22-10-13-25-14-11-22)26-12-4-1-5-21-34(30,31)28(23-6-2-3-7-23)33-20-17-27-15-18-32-19-16-27/h8-11,13-14,23H,1-7,12,15-21H2,(H,26,29)/b9-8+ |
| InChIKey | DKHRHBOJFJUFPA-CMDGGOBGSA-N |
| XLogP | 2.22 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|