C26H42N4O4S — CID 70872495
(E)-N-[6-[[1-(3-morpholin-4-ylpropyl)cyclopentyl]sulfonylamino]hexyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 70872495) has the molecular formula C26H42N4O4S and a molecular weight of 506.71 g/mol. Its IUPAC name is (E)-N-[6-[[1-(3-morpholin-4-ylpropyl)cyclopentyl]sulfonylamino]hexyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[6-[[1-(3-morpholin-4-ylpropyl)cyclopentyl]sulfonylamino]hexyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 70872495 |
| Molecular Formula | C26H42N4O4S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (E)-N-[6-[[1-(3-morpholin-4-ylpropyl)cyclopentyl]sulfonylamino]hexyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)NCCCCCCNS(=O)(=O)C1(CCCN2CCOCC2)CCCC1 |
| InChI | InChI=1S/C26H42N4O4S/c31-25(11-10-24-9-7-15-27-23-24)28-16-5-1-2-6-17-29-35(32,33)26(12-3-4-13-26)14-8-18-30-19-21-34-22-20-30/h7,9-11,15,23,29H,1-6,8,12-14,16-22H2,(H,28,31)/b11-10+ |
| InChIKey | UVEGNUHZSDQCFV-ZHACJKMWSA-N |
| XLogP | 3.12 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|