C29H34N4O — CID 67937869
N-[4-(4-methyl-2,2-diphenylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 67937869) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is N-[4-(4-methyl-2,2-diphenylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | N-[4-(4-methyl-2,2-diphenylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 67937869 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | N-[4-(4-methyl-2,2-diphenylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CN1CCN(CCCCNC(=O)C=Cc2cccnc2)C(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C29H34N4O/c1-32-21-22-33(20-9-8-19-31-28(34)17-16-25-11-10-18-30-23-25)29(24-32,26-12-4-2-5-13-26)27-14-6-3-7-15-27/h2-7,10-18,23H,8-9,19-22,24H2,1H3,(H,31,34) |
| InChIKey | GIPABESIJSOJOE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|