C29H32N4O — CID 66595349
(Z)-N-[4-[4-(9H-fluoren-9-yl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 66595349) has the molecular formula C29H32N4O and a molecular weight of 452.60 g/mol. Its IUPAC name is (Z)-N-[4-[4-(9H-fluoren-9-yl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (Z)-N-[4-[4-(9H-fluoren-9-yl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 66595349 |
| Molecular Formula | C29H32N4O |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (Z)-N-[4-[4-(9H-fluoren-9-yl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C\c1cccnc1)NCCCCN1CCN(C2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C29H32N4O/c34-28(14-13-23-8-7-15-30-22-23)31-16-5-6-17-32-18-20-33(21-19-32)29-26-11-3-1-9-24(26)25-10-2-4-12-27(25)29/h1-4,7-15,22,29H,5-6,16-21H2,(H,31,34)/b14-13- |
| InChIKey | TUZOVDPUVJVOFJ-YPKPFQOOSA-N |
| XLogP | 4.38 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|