C26H33N3O2 — CID 68649734
N-[6-(1-benzoylpiperidin-4-yl)hexyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 68649734) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[6-(1-benzoylpiperidin-4-yl)hexyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | N-[6-(1-benzoylpiperidin-4-yl)hexyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 68649734 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-[6-(1-benzoylpiperidin-4-yl)hexyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccnc1)NCCCCCCC1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H33N3O2/c30-25(14-13-23-10-8-17-27-21-23)28-18-7-2-1-4-9-22-15-19-29(20-16-22)26(31)24-11-5-3-6-12-24/h3,5-6,8,10-14,17,21-22H,1-2,4,7,9,15-16,18-20H2,(H,28,30) |
| InChIKey | YNVDXMVUUBLCDC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|