C26H32N4O4 — CID 134458747
methyl 3-amino-5-[4-[4-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]butyl]piperidine-1-carbonyl]benzoate (PubChem CID 134458747) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is methyl 3-amino-5-[4-[4-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]butyl]piperidine-1-carbonyl]benzoate.
| Compound Name | methyl 3-amino-5-[4-[4-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]butyl]piperidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 134458747 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | methyl 3-amino-5-[4-[4-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]butyl]piperidine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1cc(N)cc(C(=O)N2CCC(CCCCNC(=O)/C=C/c3cccnc3)CC2)c1 |
| InChI | InChI=1S/C26H32N4O4/c1-34-26(33)22-15-21(16-23(27)17-22)25(32)30-13-9-19(10-14-30)5-2-3-12-29-24(31)8-7-20-6-4-11-28-18-20/h4,6-8,11,15-19H,2-3,5,9-10,12-14,27H2,1H3,(H,29,31)/b8-7+ |
| InChIKey | GQVALVGTGUAXFH-BQYQJAHWSA-N |
| XLogP | 3.30 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|