C46H51N3O6 — CID 44555179
(E)-N-[4-(1-benzoylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide;7-benzyl-2,3-dihydroxy-6-methyl-4-propylnaphthalene-1-carboxylic acid (PubChem CID 44555179) has the molecular formula C46H51N3O6 and a molecular weight of 741.93 g/mol. Its IUPAC name is (E)-N-[4-(1-benzoylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide;7-benzyl-2,3-dihydroxy-6-methyl-4-propylnaphthalene-1-carboxylic acid.
| Compound Name | (E)-N-[4-(1-benzoylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide;7-benzyl-2,3-dihydroxy-6-methyl-4-propylnaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 44555179 |
| Molecular Formula | C46H51N3O6 |
| Molecular Weight | 741.93 g/mol |
| Exact Mass | 741.38 |
| IUPAC Name | (E)-N-[4-(1-benzoylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide;7-benzyl-2,3-dihydroxy-6-methyl-4-propylnaphthalene-1-carboxylic acid |
| SMILES | CCCc1c(O)c(O)c(C(=O)O)c2cc(Cc3ccccc3)c(C)cc12.O=C(/C=C/c1cccnc1)NCCCCC1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N3O2.C22H22O4/c28-23(12-11-21-8-6-15-25-19-21)26-16-5-4-7-20-13-17-27(18-14-20)24(29)22-9-2-1-3-10-22;1-3-7-16-17-10-13(2)15(11-14-8-5-4-6-9-14)12-18(17)19(22(25)26)21(24)20(16)23/h1-3,6,8-12,15,19-20H,4-5,7,13-14,16-18H2,(H,26,28);4-6,8-10,12,23-24H,3,7,11H2,1-2H3,(H,25,26)/b12-11+; |
| InChIKey | RIUDZKXAOUXIGA-CALJPSDSSA-N |
| XLogP | 8.73 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.93 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|