C25H30N4O4 — CID 175007745
[3-[4-[4-(3-pyridin-3-ylprop-2-enoylamino)butyl]piperidine-1-carbonyl]phenyl] carbamate (PubChem CID 175007745) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is [3-[4-[4-(3-pyridin-3-ylprop-2-enoylamino)butyl]piperidine-1-carbonyl]phenyl] carbamate.
| Compound Name | [3-[4-[4-(3-pyridin-3-ylprop-2-enoylamino)butyl]piperidine-1-carbonyl]phenyl] carbamate |
|---|---|
| PubChem CID | 175007745 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [3-[4-[4-(3-pyridin-3-ylprop-2-enoylamino)butyl]piperidine-1-carbonyl]phenyl] carbamate |
| SMILES | NC(=O)Oc1cccc(C(=O)N2CCC(CCCCNC(=O)C=Cc3cccnc3)CC2)c1 |
| InChI | InChI=1S/C25H30N4O4/c26-25(32)33-22-8-3-7-21(17-22)24(31)29-15-11-19(12-16-29)5-1-2-14-28-23(30)10-9-20-6-4-13-27-18-20/h3-4,6-10,13,17-19H,1-2,5,11-12,14-16H2,(H2,26,32)(H,28,30) |
| InChIKey | JOIYSJJTNLUSMV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|