C30H35N3O3S — CID 174371307
N-[4-[1-(3-naphthalen-2-ylprop-2-enylsulfonyl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 174371307) has the molecular formula C30H35N3O3S and a molecular weight of 517.70 g/mol. Its IUPAC name is N-[4-[1-(3-naphthalen-2-ylprop-2-enylsulfonyl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | N-[4-[1-(3-naphthalen-2-ylprop-2-enylsulfonyl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 174371307 |
| Molecular Formula | C30H35N3O3S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | N-[4-[1-(3-naphthalen-2-ylprop-2-enylsulfonyl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccnc1)NCCCCC1CCN(S(=O)(=O)CC=Cc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C30H35N3O3S/c34-30(15-13-27-8-5-18-31-24-27)32-19-4-3-7-25-16-20-33(21-17-25)37(35,36)22-6-9-26-12-14-28-10-1-2-11-29(28)23-26/h1-2,5-6,8-15,18,23-25H,3-4,7,16-17,19-22H2,(H,32,34) |
| InChIKey | IRQKEVCGZLYCSU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|