C60H74N8O3 — CID 173375719
bis(N-[4-(4-benzhydryl-2-methylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide);hydrate (PubChem CID 173375719) has the molecular formula C60H74N8O3 and a molecular weight of 955.31 g/mol. Its IUPAC name is bis(N-[4-(4-benzhydryl-2-methylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide);hydrate.
| Compound Name | bis(N-[4-(4-benzhydryl-2-methylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide);hydrate |
|---|---|
| PubChem CID | 173375719 |
| Molecular Formula | C60H74N8O3 |
| Molecular Weight | 955.31 g/mol |
| Exact Mass | 954.59 |
| IUPAC Name | bis(N-[4-(4-benzhydryl-2-methylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide);hydrate |
| SMILES | CC1CN(C(c2ccccc2)c2ccccc2)CCN1CCCCNC(=O)C=Cc1cccnc1.CC1CN(C(c2ccccc2)c2ccccc2)CCN1CCCCNC(=O)C=Cc1cccnc1.O |
| InChI | InChI=1S/2C30H36N4O.H2O/c2*1-25-24-34(30(27-12-4-2-5-13-27)28-14-6-3-7-15-28)22-21-33(25)20-9-8-19-32-29(35)17-16-26-11-10-18-31-23-26;/h2*2-7,10-18,23,25,30H,8-9,19-22,24H2,1H3,(H,32,35);1H2 |
| InChIKey | QFYGMPNPQJEQEZ-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.31 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|