C28H32N4O2 — CID 87236024
(Z)-N-[3-(4-benzhydrylpiperazin-1-yl)propoxy]-3-pyridin-3-ylprop-2-enamide (PubChem CID 87236024) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is (Z)-N-[3-(4-benzhydrylpiperazin-1-yl)propoxy]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (Z)-N-[3-(4-benzhydrylpiperazin-1-yl)propoxy]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 87236024 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (Z)-N-[3-(4-benzhydrylpiperazin-1-yl)propoxy]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C\c1cccnc1)NOCCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H32N4O2/c33-27(15-14-24-9-7-16-29-23-24)30-34-22-8-17-31-18-20-32(21-19-31)28(25-10-3-1-4-11-25)26-12-5-2-6-13-26/h1-7,9-16,23,28H,8,17-22H2,(H,30,33)/b15-14- |
| InChIKey | ZRQFPVUHZSYAPT-PFONDFGASA-N |
| XLogP | 3.94 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|