C25H43N5O5S — CID 46183166
1-[6-[cyclohexyl(2-morpholin-4-ylethoxy)sulfamoyl]hexyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 46183166) has the molecular formula C25H43N5O5S and a molecular weight of 525.72 g/mol. Its IUPAC name is 1-[6-[cyclohexyl(2-morpholin-4-ylethoxy)sulfamoyl]hexyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[6-[cyclohexyl(2-morpholin-4-ylethoxy)sulfamoyl]hexyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 46183166 |
| Molecular Formula | C25H43N5O5S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 1-[6-[cyclohexyl(2-morpholin-4-ylethoxy)sulfamoyl]hexyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCCCCCCS(=O)(=O)N(OCCN1CCOCC1)C1CCCCC1)NCc1cccnc1 |
| InChI | InChI=1S/C25H43N5O5S/c31-25(28-22-23-9-8-12-26-21-23)27-13-6-1-2-7-20-36(32,33)30(24-10-4-3-5-11-24)35-19-16-29-14-17-34-18-15-29/h8-9,12,21,24H,1-7,10-11,13-20,22H2,(H2,27,28,31) |
| InChIKey | RUKIBNRHSLVJQR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|