C25H36ClN5O4S — CID 46183403
1-[6-[(4-chlorophenyl)-(2-morpholin-4-ylethyl)sulfamoyl]hexyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 46183403) has the molecular formula C25H36ClN5O4S and a molecular weight of 538.11 g/mol. Its IUPAC name is 1-[6-[(4-chlorophenyl)-(2-morpholin-4-ylethyl)sulfamoyl]hexyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[6-[(4-chlorophenyl)-(2-morpholin-4-ylethyl)sulfamoyl]hexyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 46183403 |
| Molecular Formula | C25H36ClN5O4S |
| Molecular Weight | 538.11 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 1-[6-[(4-chlorophenyl)-(2-morpholin-4-ylethyl)sulfamoyl]hexyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCCCCCCS(=O)(=O)N(CCN1CCOCC1)c1ccc(Cl)cc1)NCc1cccnc1 |
| InChI | InChI=1S/C25H36ClN5O4S/c26-23-7-9-24(10-8-23)31(14-13-30-15-17-35-18-16-30)36(33,34)19-4-2-1-3-12-28-25(32)29-21-22-6-5-11-27-20-22/h5-11,20H,1-4,12-19,21H2,(H2,28,29,32) |
| InChIKey | AAGWMXRIEQDHPH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.11 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|