C21H30N4O4S — CID 89004093
1-[6-[methylsulfonyl(phenylmethoxy)amino]hexyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 89004093) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-[6-[methylsulfonyl(phenylmethoxy)amino]hexyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[6-[methylsulfonyl(phenylmethoxy)amino]hexyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 89004093 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[6-[methylsulfonyl(phenylmethoxy)amino]hexyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CS(=O)(=O)N(CCCCCCNC(=O)NCc1cccnc1)OCc1ccccc1 |
| InChI | InChI=1S/C21H30N4O4S/c1-30(27,28)25(29-18-19-10-5-4-6-11-19)15-8-3-2-7-14-23-21(26)24-17-20-12-9-13-22-16-20/h4-6,9-13,16H,2-3,7-8,14-15,17-18H2,1H3,(H2,23,24,26) |
| InChIKey | FOOYCUQCUKSDKQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|