C22H29N3O4S — CID 46235692
(E)-N-[6-[methyl(phenylmethoxy)sulfamoyl]hexyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 46235692) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is (E)-N-[6-[methyl(phenylmethoxy)sulfamoyl]hexyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[6-[methyl(phenylmethoxy)sulfamoyl]hexyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 46235692 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (E)-N-[6-[methyl(phenylmethoxy)sulfamoyl]hexyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CN(OCc1ccccc1)S(=O)(=O)CCCCCCNC(=O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C22H29N3O4S/c1-25(29-19-21-10-5-4-6-11-21)30(27,28)17-8-3-2-7-16-24-22(26)14-13-20-12-9-15-23-18-20/h4-6,9-15,18H,2-3,7-8,16-17,19H2,1H3,(H,24,26)/b14-13+ |
| InChIKey | HNPJVDIJTBUJEU-BUHFOSPRSA-N |
| XLogP | 3.16 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|