C32H41N3O2 — CID 145100156
(E)-N-[5-[4-[[2-(2-methoxyphenyl)ethyl-propan-2-ylamino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 145100156) has the molecular formula C32H41N3O2 and a molecular weight of 499.70 g/mol. Its IUPAC name is (E)-N-[5-[4-[[2-(2-methoxyphenyl)ethyl-propan-2-ylamino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[4-[[2-(2-methoxyphenyl)ethyl-propan-2-ylamino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 145100156 |
| Molecular Formula | C32H41N3O2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | (E)-N-[5-[4-[[2-(2-methoxyphenyl)ethyl-propan-2-ylamino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | COc1ccccc1CCN(Cc1ccc(CCCCCNC(=O)/C=C/c2cccnc2)cc1)C(C)C |
| InChI | InChI=1S/C32H41N3O2/c1-26(2)35(23-20-30-12-6-7-13-31(30)37-3)25-29-16-14-27(15-17-29)10-5-4-8-22-34-32(36)19-18-28-11-9-21-33-24-28/h6-7,9,11-19,21,24,26H,4-5,8,10,20,22-23,25H2,1-3H3,(H,34,36)/b19-18+ |
| InChIKey | ABJJGWMLNQSGAZ-VHEBQXMUSA-N |
| XLogP | 6.09 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|