C34H39F3N4O — CID 145100165
(E)-N-[5-[4-[[propan-2-yl-[2-[6-(trifluoromethyl)-1H-indol-3-yl]ethyl]amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 145100165) has the molecular formula C34H39F3N4O and a molecular weight of 576.71 g/mol. Its IUPAC name is (E)-N-[5-[4-[[propan-2-yl-[2-[6-(trifluoromethyl)-1H-indol-3-yl]ethyl]amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[4-[[propan-2-yl-[2-[6-(trifluoromethyl)-1H-indol-3-yl]ethyl]amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 145100165 |
| Molecular Formula | C34H39F3N4O |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | (E)-N-[5-[4-[[propan-2-yl-[2-[6-(trifluoromethyl)-1H-indol-3-yl]ethyl]amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC(C)N(CCc1c[nH]c2cc(C(F)(F)F)ccc12)Cc1ccc(CCCCCNC(=O)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C34H39F3N4O/c1-25(2)41(20-17-29-23-40-32-21-30(34(35,36)37)14-15-31(29)32)24-28-11-9-26(10-12-28)7-4-3-5-19-39-33(42)16-13-27-8-6-18-38-22-27/h6,8-16,18,21-23,25,40H,3-5,7,17,19-20,24H2,1-2H3,(H,39,42)/b16-13+ |
| InChIKey | MXEKROTYHJENKF-DTQAZKPQSA-N |
| XLogP | 7.58 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|