C32H38N4O — CID 145100137
(E)-N-[5-[4-[[1H-indol-3-ylmethyl(propan-2-yl)amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 145100137) has the molecular formula C32H38N4O and a molecular weight of 494.68 g/mol. Its IUPAC name is (E)-N-[5-[4-[[1H-indol-3-ylmethyl(propan-2-yl)amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[4-[[1H-indol-3-ylmethyl(propan-2-yl)amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 145100137 |
| Molecular Formula | C32H38N4O |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | (E)-N-[5-[4-[[1H-indol-3-ylmethyl(propan-2-yl)amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC(C)N(Cc1ccc(CCCCCNC(=O)/C=C/c2cccnc2)cc1)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C32H38N4O/c1-25(2)36(24-29-22-35-31-12-6-5-11-30(29)31)23-28-15-13-26(14-16-28)9-4-3-7-20-34-32(37)18-17-27-10-8-19-33-21-27/h5-6,8,10-19,21-22,25,35H,3-4,7,9,20,23-24H2,1-2H3,(H,34,37)/b18-17+ |
| InChIKey | RPLPUMDDXYUBQD-ISLYRVAYSA-N |
| XLogP | 6.52 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|