C34H42N4O — CID 145100142
(E)-N-[5-[4-[2-[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]ethyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 145100142) has the molecular formula C34H42N4O and a molecular weight of 522.74 g/mol. Its IUPAC name is (E)-N-[5-[4-[2-[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]ethyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[4-[2-[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]ethyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 145100142 |
| Molecular Formula | C34H42N4O |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | (E)-N-[5-[4-[2-[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]ethyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC(C)N(CCc1ccc(CCCCCNC(=O)/C=C/c2cccnc2)cc1)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C34H42N4O/c1-27(2)38(24-20-31-26-37-33-12-6-5-11-32(31)33)23-19-29-15-13-28(14-16-29)9-4-3-7-22-36-34(39)18-17-30-10-8-21-35-25-30/h5-6,8,10-18,21,25-27,37H,3-4,7,9,19-20,22-24H2,1-2H3,(H,36,39)/b18-17+ |
| InChIKey | GHUNZACTFCNKGL-ISLYRVAYSA-N |
| XLogP | 6.60 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|