C32H38N4O2 — CID 145100168
(E)-N-[4-[4-[[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]methyl]phenoxy]butyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 145100168) has the molecular formula C32H38N4O2 and a molecular weight of 510.68 g/mol. Its IUPAC name is (E)-N-[4-[4-[[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]methyl]phenoxy]butyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-[4-[[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]methyl]phenoxy]butyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 145100168 |
| Molecular Formula | C32H38N4O2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | (E)-N-[4-[4-[[2-(1H-indol-3-yl)ethyl-propan-2-ylamino]methyl]phenoxy]butyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC(C)N(CCc1c[nH]c2ccccc12)Cc1ccc(OCCCCNC(=O)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C32H38N4O2/c1-25(2)36(20-17-28-23-35-31-10-4-3-9-30(28)31)24-27-11-14-29(15-12-27)38-21-6-5-19-34-32(37)16-13-26-8-7-18-33-22-26/h3-4,7-16,18,22-23,25,35H,5-6,17,19-21,24H2,1-2H3,(H,34,37)/b16-13+ |
| InChIKey | XJFSTTSWMXBIKW-DTQAZKPQSA-N |
| XLogP | 6.00 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|