C30H34N4O — CID 145100169
(E)-N-[3-[4-[[ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]propyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 145100169) has the molecular formula C30H34N4O and a molecular weight of 466.63 g/mol. Its IUPAC name is (E)-N-[3-[4-[[ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]propyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[3-[4-[[ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]propyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 145100169 |
| Molecular Formula | C30H34N4O |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (E)-N-[3-[4-[[ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]propyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CCN(CCc1c[nH]c2ccccc12)Cc1ccc(CCCNC(=O)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C30H34N4O/c1-2-34(20-17-27-22-33-29-10-4-3-9-28(27)29)23-26-13-11-24(12-14-26)7-6-19-32-30(35)16-15-25-8-5-18-31-21-25/h3-5,8-16,18,21-22,33H,2,6-7,17,19-20,23H2,1H3,(H,32,35)/b16-15+ |
| InChIKey | QGUPDZGQUUWXHT-FOCLMDBBSA-N |
| XLogP | 5.39 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|