C28H35N3O2 — CID 142124083
4-[2-(1H-indol-3-yl)ethyl-[[4-[(E)-4-methyl-3-oxopent-1-enyl]phenyl]methyl]amino]-N-methylbutanamide (PubChem CID 142124083) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 4-[2-(1H-indol-3-yl)ethyl-[[4-[(E)-4-methyl-3-oxopent-1-enyl]phenyl]methyl]amino]-N-methylbutanamide.
| Compound Name | 4-[2-(1H-indol-3-yl)ethyl-[[4-[(E)-4-methyl-3-oxopent-1-enyl]phenyl]methyl]amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 142124083 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 4-[2-(1H-indol-3-yl)ethyl-[[4-[(E)-4-methyl-3-oxopent-1-enyl]phenyl]methyl]amino]-N-methylbutanamide |
| SMILES | CNC(=O)CCCN(CCc1c[nH]c2ccccc12)Cc1ccc(/C=C/C(=O)C(C)C)cc1 |
| InChI | InChI=1S/C28H35N3O2/c1-21(2)27(32)15-14-22-10-12-23(13-11-22)20-31(17-6-9-28(33)29-3)18-16-24-19-30-26-8-5-4-7-25(24)26/h4-5,7-8,10-15,19,21,30H,6,9,16-18,20H2,1-3H3,(H,29,33)/b15-14+ |
| InChIKey | LLICZWZKRMFYSM-CCEZHUSRSA-N |
| XLogP | 4.98 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|