C39H42N6O5 — CID 167565744
(E)-3-[4-[[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N-methylprop-2-enamide (PubChem CID 167565744) has the molecular formula C39H42N6O5 and a molecular weight of 674.80 g/mol. Its IUPAC name is (E)-3-[4-[[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[4-[[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 167565744 |
| Molecular Formula | C39H42N6O5 |
| Molecular Weight | 674.80 g/mol |
| Exact Mass | 674.32 |
| IUPAC Name | (E)-3-[4-[[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C/c1ccc(CN(CCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C39H42N6O5/c1-40-34(46)18-16-26-12-14-27(15-13-26)25-44(23-20-28-24-42-31-10-4-3-8-29(28)31)22-6-2-5-21-41-32-11-7-9-30-36(32)39(50)45(38(30)49)33-17-19-35(47)43-37(33)48/h3-4,7-16,18,24,33,41-42H,2,5-6,17,19-23,25H2,1H3,(H,40,46)(H,43,47,48)/b18-16+ |
| InChIKey | SAPPYUTXJWXRJZ-FBMGVBCBSA-N |
| XLogP | 4.66 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|