C38H40N6O6 — CID 167565743
(E)-3-[4-[[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N-methylprop-2-enamide (PubChem CID 167565743) has the molecular formula C38H40N6O6 and a molecular weight of 676.77 g/mol. Its IUPAC name is (E)-3-[4-[[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[4-[[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 167565743 |
| Molecular Formula | C38H40N6O6 |
| Molecular Weight | 676.77 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | (E)-3-[4-[[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C/c1ccc(CN(CCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C38H40N6O6/c1-39-33(45)15-13-25-9-11-26(12-10-25)24-43(19-17-27-23-41-30-7-3-2-5-28(27)30)20-22-50-21-18-40-31-8-4-6-29-35(31)38(49)44(37(29)48)32-14-16-34(46)42-36(32)47/h2-13,15,23,32,40-41H,14,16-22,24H2,1H3,(H,39,45)(H,42,46,47)/b15-13+ |
| InChIKey | NQYMNAHKFVTXJT-FYWRMAATSA-N |
| XLogP | 3.50 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|