C32H37N5O3 — CID 89311656
N-[2-[[4-[(E)-3-[amino(hydroxy)amino]-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl]-3-phenylbutanamide (PubChem CID 89311656) has the molecular formula C32H37N5O3 and a molecular weight of 539.68 g/mol. Its IUPAC name is N-[2-[[4-[(E)-3-[amino(hydroxy)amino]-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl]-3-phenylbutanamide.
| Compound Name | N-[2-[[4-[(E)-3-[amino(hydroxy)amino]-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 89311656 |
| Molecular Formula | C32H37N5O3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | N-[2-[[4-[(E)-3-[amino(hydroxy)amino]-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl]-3-phenylbutanamide |
| SMILES | CC(CC(=O)NCCN(CCc1c[nH]c2ccccc12)Cc1ccc(/C=C/C(=O)N(N)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H37N5O3/c1-24(27-7-3-2-4-8-27)21-31(38)34-18-20-36(19-17-28-22-35-30-10-6-5-9-29(28)30)23-26-13-11-25(12-14-26)15-16-32(39)37(33)40/h2-16,22,24,35,40H,17-21,23,33H2,1H3,(H,34,38)/b16-15+ |
| InChIKey | KQNWDVOLJLILQO-FOCLMDBBSA-N |
| XLogP | 4.63 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|