C27H32N4O4 — CID 20579313
2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl N-(cyclopropylmethyl)carbamate (PubChem CID 20579313) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl N-(cyclopropylmethyl)carbamate.
| Compound Name | 2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl N-(cyclopropylmethyl)carbamate |
|---|---|
| PubChem CID | 20579313 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl N-(cyclopropylmethyl)carbamate |
| SMILES | O=C(/C=C/c1ccc(CN(CCOC(=O)NCC2CC2)CCc2c[nH]c3ccccc23)cc1)NO |
| InChI | InChI=1S/C27H32N4O4/c32-26(30-34)12-11-20-5-9-22(10-6-20)19-31(15-16-35-27(33)29-17-21-7-8-21)14-13-23-18-28-25-4-2-1-3-24(23)25/h1-6,9-12,18,21,28,34H,7-8,13-17,19H2,(H,29,33)(H,30,32)/b12-11+ |
| InChIKey | FUXVSNQRUDFKHU-VAWYXSNFSA-N |
| XLogP | 3.87 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|