C33H44N4O3 — CID 170703764
(E)-3-[4-[[2-(3-cyclopentyl-3-oxopropoxy)ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N'-propylprop-2-enehydrazide (PubChem CID 170703764) has the molecular formula C33H44N4O3 and a molecular weight of 544.74 g/mol. Its IUPAC name is (E)-3-[4-[[2-(3-cyclopentyl-3-oxopropoxy)ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N'-propylprop-2-enehydrazide.
| Compound Name | (E)-3-[4-[[2-(3-cyclopentyl-3-oxopropoxy)ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N'-propylprop-2-enehydrazide |
|---|---|
| PubChem CID | 170703764 |
| Molecular Formula | C33H44N4O3 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | (E)-3-[4-[[2-(3-cyclopentyl-3-oxopropoxy)ethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]-N'-propylprop-2-enehydrazide |
| SMILES | CCCNNC(=O)/C=C/c1ccc(CN(CCOCCC(=O)C2CCCC2)CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C33H44N4O3/c1-2-19-35-36-33(39)16-15-26-11-13-27(14-12-26)25-37(20-17-29-24-34-31-10-6-5-9-30(29)31)21-23-40-22-18-32(38)28-7-3-4-8-28/h5-6,9-16,24,28,34-35H,2-4,7-8,17-23,25H2,1H3,(H,36,39)/b16-15+ |
| InChIKey | PMDRHBNSZKGOCK-FOCLMDBBSA-N |
| XLogP | 5.42 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|