C27H37N3O5S — CID 75303430
N-[7-[benzylsulfonyl(oxan-2-yloxy)amino]heptyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 75303430) has the molecular formula C27H37N3O5S and a molecular weight of 515.68 g/mol. Its IUPAC name is N-[7-[benzylsulfonyl(oxan-2-yloxy)amino]heptyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | N-[7-[benzylsulfonyl(oxan-2-yloxy)amino]heptyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 75303430 |
| Molecular Formula | C27H37N3O5S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | N-[7-[benzylsulfonyl(oxan-2-yloxy)amino]heptyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccnc1)NCCCCCCCN(OC1CCCCO1)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H37N3O5S/c31-26(17-16-24-14-11-18-28-22-24)29-19-8-2-1-3-9-20-30(35-27-15-7-10-21-34-27)36(32,33)23-25-12-5-4-6-13-25/h4-6,11-14,16-18,22,27H,1-3,7-10,15,19-21,23H2,(H,29,31) |
| InChIKey | IXPRWPFGAVJHTA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|