C26H39N3O6S — CID 72736376
N-cyclohexyl-6-(1,3-dioxoisoindol-2-yl)-N-(2-morpholin-4-ylethoxy)hexane-1-sulfonamide (PubChem CID 72736376) has the molecular formula C26H39N3O6S and a molecular weight of 521.68 g/mol. Its IUPAC name is N-cyclohexyl-6-(1,3-dioxoisoindol-2-yl)-N-(2-morpholin-4-ylethoxy)hexane-1-sulfonamide.
| Compound Name | N-cyclohexyl-6-(1,3-dioxoisoindol-2-yl)-N-(2-morpholin-4-ylethoxy)hexane-1-sulfonamide |
|---|---|
| PubChem CID | 72736376 |
| Molecular Formula | C26H39N3O6S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | N-cyclohexyl-6-(1,3-dioxoisoindol-2-yl)-N-(2-morpholin-4-ylethoxy)hexane-1-sulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCS(=O)(=O)N(OCCN1CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C26H39N3O6S/c30-25-23-12-6-7-13-24(23)26(31)28(25)14-8-1-2-9-21-36(32,33)29(22-10-4-3-5-11-22)35-20-17-27-15-18-34-19-16-27/h6-7,12-13,22H,1-5,8-11,14-21H2 |
| InChIKey | IYVOICJNXVPGQV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|