C26H43N5O4 — CID 91105238
N-cyclohexyl-2-(2-morpholin-4-ylethoxy)-7-(pyridin-2-ylmethylcarbamoylamino)heptanamide (PubChem CID 91105238) has the molecular formula C26H43N5O4 and a molecular weight of 489.66 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-morpholin-4-ylethoxy)-7-(pyridin-2-ylmethylcarbamoylamino)heptanamide.
| Compound Name | N-cyclohexyl-2-(2-morpholin-4-ylethoxy)-7-(pyridin-2-ylmethylcarbamoylamino)heptanamide |
|---|---|
| PubChem CID | 91105238 |
| Molecular Formula | C26H43N5O4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | N-cyclohexyl-2-(2-morpholin-4-ylethoxy)-7-(pyridin-2-ylmethylcarbamoylamino)heptanamide |
| SMILES | O=C(NCCCCCC(OCCN1CCOCC1)C(=O)NC1CCCCC1)NCc1ccccn1 |
| InChI | InChI=1S/C26H43N5O4/c32-25(30-22-9-3-1-4-10-22)24(35-20-17-31-15-18-34-19-16-31)12-5-2-7-14-28-26(33)29-21-23-11-6-8-13-27-23/h6,8,11,13,22,24H,1-5,7,9-10,12,14-21H2,(H,30,32)(H2,28,29,33) |
| InChIKey | DDHAOTBXQLCHEO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|