C25H41N5O4 — CID 90951494
N-cyclohexyl-2-(2-morpholin-4-ylethoxy)-7-(pyridin-4-ylcarbamoylamino)heptanamide (PubChem CID 90951494) has the molecular formula C25H41N5O4 and a molecular weight of 475.63 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-morpholin-4-ylethoxy)-7-(pyridin-4-ylcarbamoylamino)heptanamide.
| Compound Name | N-cyclohexyl-2-(2-morpholin-4-ylethoxy)-7-(pyridin-4-ylcarbamoylamino)heptanamide |
|---|---|
| PubChem CID | 90951494 |
| Molecular Formula | C25H41N5O4 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | N-cyclohexyl-2-(2-morpholin-4-ylethoxy)-7-(pyridin-4-ylcarbamoylamino)heptanamide |
| SMILES | O=C(NCCCCCC(OCCN1CCOCC1)C(=O)NC1CCCCC1)Nc1ccncc1 |
| InChI | InChI=1S/C25H41N5O4/c31-24(28-21-7-3-1-4-8-21)23(34-20-17-30-15-18-33-19-16-30)9-5-2-6-12-27-25(32)29-22-10-13-26-14-11-22/h10-11,13-14,21,23H,1-9,12,15-20H2,(H,28,31)(H2,26,27,29,32) |
| InChIKey | LFCBUTYOYXDCDW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|