C28H36N6O3 — CID 50898764
1-cyclohexyl-3-[4-[[7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea (PubChem CID 50898764) has the molecular formula C28H36N6O3 and a molecular weight of 504.64 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[[7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-[[7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 50898764 |
| Molecular Formula | C28H36N6O3 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 1-cyclohexyl-3-[4-[[7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea |
| SMILES | O=C(Nc1ccc(Nc2ncnc3cc(OCCCN4CCOCC4)ccc23)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C28H36N6O3/c35-28(32-21-5-2-1-3-6-21)33-23-9-7-22(8-10-23)31-27-25-12-11-24(19-26(25)29-20-30-27)37-16-4-13-34-14-17-36-18-15-34/h7-12,19-21H,1-6,13-18H2,(H,29,30,31)(H2,32,33,35) |
| InChIKey | BVSXEPUYNGJRDW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|