C31H41N7O3 — CID 58770838
N-(4-morpholin-4-ylphenyl)-4-[7-(3-piperazin-1-ylpropoxy)quinazolin-4-yl]piperidine-1-carboxamide (PubChem CID 58770838) has the molecular formula C31H41N7O3 and a molecular weight of 559.72 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-4-[7-(3-piperazin-1-ylpropoxy)quinazolin-4-yl]piperidine-1-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-4-[7-(3-piperazin-1-ylpropoxy)quinazolin-4-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58770838 |
| Molecular Formula | C31H41N7O3 |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-4-[7-(3-piperazin-1-ylpropoxy)quinazolin-4-yl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)N1CCC(c2ncnc3cc(OCCCN4CCNCC4)ccc23)CC1 |
| InChI | InChI=1S/C31H41N7O3/c39-31(35-25-2-4-26(5-3-25)37-17-20-40-21-18-37)38-13-8-24(9-14-38)30-28-7-6-27(22-29(28)33-23-34-30)41-19-1-12-36-15-10-32-11-16-36/h2-7,22-24,32H,1,8-21H2,(H,35,39) |
| InChIKey | GRCQLGZQKFMCAG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|