C31H46N4O4S — CID 143371591
ethane;4-[7-(3-methylsulfanyloxypropoxy)quinazolin-4-yl]-N-(4-propan-2-yloxyphenyl)piperidine-1-carboxamide (PubChem CID 143371591) has the molecular formula C31H46N4O4S and a molecular weight of 570.80 g/mol. Its IUPAC name is ethane;4-[7-(3-methylsulfanyloxypropoxy)quinazolin-4-yl]-N-(4-propan-2-yloxyphenyl)piperidine-1-carboxamide.
| Compound Name | ethane;4-[7-(3-methylsulfanyloxypropoxy)quinazolin-4-yl]-N-(4-propan-2-yloxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143371591 |
| Molecular Formula | C31H46N4O4S |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | ethane;4-[7-(3-methylsulfanyloxypropoxy)quinazolin-4-yl]-N-(4-propan-2-yloxyphenyl)piperidine-1-carboxamide |
| SMILES | CC.CC.CSOCCCOc1ccc2c(C3CCN(C(=O)Nc4ccc(OC(C)C)cc4)CC3)ncnc2c1 |
| InChI | InChI=1S/C27H34N4O4S.2C2H6/c1-19(2)35-22-7-5-21(6-8-22)30-27(32)31-13-11-20(12-14-31)26-24-10-9-23(17-25(24)28-18-29-26)33-15-4-16-34-36-3;2*1-2/h5-10,17-20H,4,11-16H2,1-3H3,(H,30,32);2*1-2H3 |
| InChIKey | OCKWGCLGLJNIGS-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|