C24H28N4O3 — CID 58770827
4-(6-methoxyquinazolin-4-yl)-N-(4-propan-2-yloxyphenyl)piperidine-1-carboxamide (PubChem CID 58770827) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-(6-methoxyquinazolin-4-yl)-N-(4-propan-2-yloxyphenyl)piperidine-1-carboxamide.
| Compound Name | 4-(6-methoxyquinazolin-4-yl)-N-(4-propan-2-yloxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58770827 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 4-(6-methoxyquinazolin-4-yl)-N-(4-propan-2-yloxyphenyl)piperidine-1-carboxamide |
| SMILES | COc1ccc2ncnc(C3CCN(C(=O)Nc4ccc(OC(C)C)cc4)CC3)c2c1 |
| InChI | InChI=1S/C24H28N4O3/c1-16(2)31-19-6-4-18(5-7-19)27-24(29)28-12-10-17(11-13-28)23-21-14-20(30-3)8-9-22(21)25-15-26-23/h4-9,14-17H,10-13H2,1-3H3,(H,27,29) |
| InChIKey | BBWQAOBSEOUWTA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |