C22H20F3N3O3 — CID 139466772
[4-(6-methoxyquinazolin-4-yl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone (PubChem CID 139466772) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is [4-(6-methoxyquinazolin-4-yl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [4-(6-methoxyquinazolin-4-yl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 139466772 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [4-(6-methoxyquinazolin-4-yl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
| SMILES | COc1ccc2ncnc(C3CCN(C(=O)c4ccc(OC(F)(F)F)cc4)CC3)c2c1 |
| InChI | InChI=1S/C22H20F3N3O3/c1-30-17-6-7-19-18(12-17)20(27-13-26-19)14-8-10-28(11-9-14)21(29)15-2-4-16(5-3-15)31-22(23,24)25/h2-7,12-14H,8-11H2,1H3 |
| InChIKey | WMAFRQLCKRLYHV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |