C23H21F3N2O3 — CID 139473480
[4-(7-methoxyquinolin-4-yl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone (PubChem CID 139473480) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is [4-(7-methoxyquinolin-4-yl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [4-(7-methoxyquinolin-4-yl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 139473480 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [4-(7-methoxyquinolin-4-yl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
| SMILES | COc1ccc2c(C3CCN(C(=O)c4ccc(OC(F)(F)F)cc4)CC3)ccnc2c1 |
| InChI | InChI=1S/C23H21F3N2O3/c1-30-18-6-7-20-19(8-11-27-21(20)14-18)15-9-12-28(13-10-15)22(29)16-2-4-17(5-3-16)31-23(24,25)26/h2-8,11,14-15H,9-10,12-13H2,1H3 |
| InChIKey | VBSDNKDEIMVTQP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |