C24H16F12N4O4S — CID 153339802
[4-[1-[4-(trifluoromethoxy)benzoyl]piperidin-4-yl]pyrido[3,2-d]pyrimidin-7-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate (PubChem CID 153339802) has the molecular formula C24H16F12N4O4S and a molecular weight of 684.46 g/mol. Its IUPAC name is [4-[1-[4-(trifluoromethoxy)benzoyl]piperidin-4-yl]pyrido[3,2-d]pyrimidin-7-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate.
| Compound Name | [4-[1-[4-(trifluoromethoxy)benzoyl]piperidin-4-yl]pyrido[3,2-d]pyrimidin-7-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate |
|---|---|
| PubChem CID | 153339802 |
| Molecular Formula | C24H16F12N4O4S |
| Molecular Weight | 684.46 g/mol |
| Exact Mass | 684.07 |
| IUPAC Name | [4-[1-[4-(trifluoromethoxy)benzoyl]piperidin-4-yl]pyrido[3,2-d]pyrimidin-7-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate |
| SMILES | O=C(c1ccc(OC(F)(F)F)cc1)N1CCC(c2ncnc3cc(OS(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cnc23)CC1 |
| InChI | InChI=1S/C24H16F12N4O4S/c25-20(26,22(29,30)31)21(27,28)23(32,33)45(42)44-15-9-16-18(37-10-15)17(39-11-38-16)12-5-7-40(8-6-12)19(41)13-1-3-14(4-2-13)43-24(34,35)36/h1-4,9-12H,5-8H2 |
| InChIKey | KFEPLRIADPNQHM-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.46 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|