C24H27N3O3 — CID 90731692
(4-propan-2-ylphenyl) 4-(7-methoxyquinazolin-4-yl)piperidine-1-carboxylate (PubChem CID 90731692) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (4-propan-2-ylphenyl) 4-(7-methoxyquinazolin-4-yl)piperidine-1-carboxylate.
| Compound Name | (4-propan-2-ylphenyl) 4-(7-methoxyquinazolin-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90731692 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (4-propan-2-ylphenyl) 4-(7-methoxyquinazolin-4-yl)piperidine-1-carboxylate |
| SMILES | COc1ccc2c(C3CCN(C(=O)Oc4ccc(C(C)C)cc4)CC3)ncnc2c1 |
| InChI | InChI=1S/C24H27N3O3/c1-16(2)17-4-6-19(7-5-17)30-24(28)27-12-10-18(11-13-27)23-21-9-8-20(29-3)14-22(21)25-15-26-23/h4-9,14-16,18H,10-13H2,1-3H3 |
| InChIKey | DEKZENLEIOMOQA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |