C20H26N4O3 — CID 69261813
4-[7-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-4-yl]piperidine-1-carboxylic acid (PubChem CID 69261813) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-[7-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-4-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[7-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-4-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69261813 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 4-[7-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-4-yl]piperidine-1-carboxylic acid |
| SMILES | CN1CCCC1COc1ccc2c(C3CCN(C(=O)O)CC3)ncnc2c1 |
| InChI | InChI=1S/C20H26N4O3/c1-23-8-2-3-15(23)12-27-16-4-5-17-18(11-16)21-13-22-19(17)14-6-9-24(10-7-14)20(25)26/h4-5,11,13-15H,2-3,6-10,12H2,1H3,(H,25,26) |
| InChIKey | UKNNVCLGTFEVJB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |