C21H29N5O3 — CID 69260554
4-[7-[4-(2-methoxyethyl)piperazin-1-yl]quinazolin-4-yl]piperidine-1-carboxylic acid (PubChem CID 69260554) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-[7-[4-(2-methoxyethyl)piperazin-1-yl]quinazolin-4-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[7-[4-(2-methoxyethyl)piperazin-1-yl]quinazolin-4-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69260554 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 4-[7-[4-(2-methoxyethyl)piperazin-1-yl]quinazolin-4-yl]piperidine-1-carboxylic acid |
| SMILES | COCCN1CCN(c2ccc3c(C4CCN(C(=O)O)CC4)ncnc3c2)CC1 |
| InChI | InChI=1S/C21H29N5O3/c1-29-13-12-24-8-10-25(11-9-24)17-2-3-18-19(14-17)22-15-23-20(18)16-4-6-26(7-5-16)21(27)28/h2-3,14-16H,4-13H2,1H3,(H,27,28) |
| InChIKey | YKUQPQYVIPBEQD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |